|
CAS#: 40334-69-8 Product: Lewisitel-2 No suppilers available for the product. |
| Name | Lewisitel-2 |
|---|---|
| Synonyms | Chloro-Bis[(E)-2-Chlorovinyl]Arsane; Arsine, Bis(2-Chlorovinyl)Chloro-; Bis(2-Chlorovinyl)Chloroarsine |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4AsCl3 |
| Molecular Weight | 233.36 |
| CAS Registry Number | 40334-69-8 |
| SMILES | Cl[As](\C=C\Cl)/C=C/Cl |
| InChI | 1S/C4H4AsCl3/c6-3-1-5(8)2-4-7/h1-4H/b3-1+,4-2+ |
| InChIKey | YRFJGLQNTWLXKO-ZPUQHVIOSA-N |
| Boiling point | 228.874°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 94.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lewisitel-2 |