Online Database of Chemicals from Around the World
|
CAS#: 40452-15-1 Product: alpha-Methyl-2-Phenanthreneacetaldehyde No suppilers available for the product. |
| Name | alpha-Methyl-2-Phenanthreneacetaldehyde |
|---|---|
| Synonyms | 2-(2-Phenanthryl)Propanal; 2-(2-Phenanthryl)Propionaldehyde; Alpha-Methyl-2-Phenanthreneacetaldehyde |
| Molecular Structure |  |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 |
| CAS Registry Number | 40452-15-1 |
| SMILES | C1=C3C(=CC=C1C(C=O)C)C2=CC=CC=C2C=C3 |
| InChI | 1S/C17H14O/c1-12(11-18)14-8-9-17-15(10-14)7-6-13-4-2-3-5-16(13)17/h2-12H,1H3 |
| InChIKey | ODMDVXBFLZLMOV-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.542°C at 760 mmHg (Cal.) |
| Flash point | 232.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-2-Phenanthreneacetaldehyde |