|
CAS#: 40649-71-6 Product: 5-Iodohistidine No suppilers available for the product. |
| Name | 5-Iodohistidine |
|---|---|
| Synonyms | (2S)-2-Amino-3-(5-Iodo-3H-Imidazol-4-Yl)Propionic Acid; 5-Iodo-L-Histidine; 5-Iodohistidine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8IN3O2 |
| Molecular Weight | 281.05 |
| CAS Registry Number | 40649-71-6 |
| SMILES | [C@H](C(=O)O)(N)CC1=C(N=C[NH]1)I |
| InChI | 1S/C6H8IN3O2/c7-5-4(9-2-10-5)1-3(8)6(11)12/h2-3H,1,8H2,(H,9,10)(H,11,12)/t3-/m0/s1 |
| InChIKey | AAKROHZJMPGWQF-VKHMYHEASA-N |
| Density | 2.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.804°C at 760 mmHg (Cal.) |
| Flash point | 271.797°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Iodohistidine |