|
CAS#: 40704-04-9 Product: 2-[4-[2-([1,1'-Biphenyl]-4-Yl)Vinyl]Phenyl]-5,7-Dimethylbenzoxazole No suppilers available for the product. |
| Name | 2-[4-[2-([1,1'-Biphenyl]-4-Yl)Vinyl]Phenyl]-5,7-Dimethylbenzoxazole |
|---|---|
| Synonyms | 5,7-Dimethyl-2-[4-[(E)-2-(4-Phenylphenyl)Vinyl]Phenyl]-1,3-Benzoxazole; 2-(4-(2-((1,1'-Biphenyl)-4-Yl)Vinyl)Phenyl)-5,7-Dimethylbenzoxazole; Benzoxazole, 2-(4-(2-((1,1'-Biphenyl)-4-Yl)Ethenyl)Phenyl)-5,7-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C29H23NO |
| Molecular Weight | 401.51 |
| CAS Registry Number | 40704-04-9 |
| EINECS | 255-048-7 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)\C=C\C3=CC=C(C=C3)C4=NC5=C(O4)C(=CC(=C5)C)C |
| InChI | 1S/C29H23NO/c1-20-18-21(2)28-27(19-20)30-29(31-28)26-16-12-23(13-17-26)9-8-22-10-14-25(15-11-22)24-6-4-3-5-7-24/h3-19H,1-2H3/b9-8+ |
| InChIKey | PQKKXHAZEZTNFG-CMDGGOBGSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.956°C at 760 mmHg (Cal.) |
| Flash point | 247.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-[2-([1,1'-Biphenyl]-4-Yl)Vinyl]Phenyl]-5,7-Dimethylbenzoxazole |