|
CAS#: 40709-29-3 Product: Perhydrohistrionicotoxin No suppilers available for the product. |
| Name | Perhydrohistrionicotoxin |
|---|---|
| Synonyms | (2R,6R,7S,8S)-2-Amyl-7-Butyl-1-Azaspiro[5.5]Undecan-8-Ol; 1-Azaspiro(5.5)Undecan-8-Ol, 7-Butyl-2-Pentyl-, (2R,6R,7S,8S)-; 1-Azaspiro(5.5)Undecan-8-Ol, 7-Butyl-2-Pentyl-, (6R-(6Alpha(R*),7Beta,8Alpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 |
| CAS Registry Number | 40709-29-3 |
| SMILES | [C@@]12(N[C@@H](CCC1)CCCCC)CCC[C@@H]([C@H]2CCCC)O |
| InChI | 1S/C19H37NO/c1-3-5-7-10-16-11-8-14-19(20-16)15-9-13-18(21)17(19)12-6-4-2/h16-18,20-21H,3-15H2,1-2H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | BTKHRQIWTGOESJ-AKHDSKFASA-N |
| Density | 0.95g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.412°C at 760 mmHg (Cal.) |
| Flash point | 52.192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perhydrohistrionicotoxin |