|
CAS#: 41028-24-4 Product: 2,6-Di-Tert-Butyl-4-[(Methylthio)Methyl]Phenol No suppilers available for the product. |
| Name | 2,6-Di-Tert-Butyl-4-[(Methylthio)Methyl]Phenol |
|---|---|
| Synonyms | 2,6-Ditert-Butyl-4-[(Methylthio)Methyl]Phenol; 2,6-Di-Tert-Butyl-4-((Methylthio)Methyl)Phenol; Bht-Sch3 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.44 |
| CAS Registry Number | 41028-24-4 |
| SMILES | C1=C(C(=C(C=C1CSC)C(C)(C)C)O)C(C)(C)C |
| InChI | 1S/C16H26OS/c1-15(2,3)12-8-11(10-18-7)9-13(14(12)17)16(4,5)6/h8-9,17H,10H2,1-7H3 |
| InChIKey | YNDWYCVIIYXSKS-UHFFFAOYSA-N |
| Density | 0.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.736°C at 760 mmHg (Cal.) |
| Flash point | 155.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Di-Tert-Butyl-4-[(Methylthio)Methyl]Phenol |