|
CAS#: 41463-67-6 Product: 5,5'-Azobis[1-Phenyl-1H-Tetrazole] No suppilers available for the product. |
| Name | 5,5'-Azobis[1-Phenyl-1H-Tetrazole] |
|---|---|
| Synonyms | (E)-Bis(1-Phenyl-5-Tetrazolyl)Diazene; (E)-Bis(1-Phenyl-1,2,3,4-Tetrazol-5-Yl)Diazene; 1H-Tetrazole, 5,5'-Azobis(1-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N10 |
| Molecular Weight | 318.30 |
| CAS Registry Number | 41463-67-6 |
| EINECS | 255-383-9 |
| SMILES | C1=CC=C(C=C1)[N]2N=NN=C2N=NC3=NN=N[N]3C4=CC=CC=C4 |
| InChI | 1S/C14H10N10/c1-3-7-11(8-4-1)23-13(17-19-21-23)15-16-14-18-20-22-24(14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RFDMWAAVQQFVFK-UHFFFAOYSA-N |
| Density | 1.566g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.08°C at 760 mmHg (Cal.) |
| Flash point | 295.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5'-Azobis[1-Phenyl-1H-Tetrazole] |