|
CAS#: 4176-53-8 Product: 1-Aminophenanthrene No suppilers available for the product. |
| Name | 1-Aminophenanthrene |
|---|---|
| Synonyms | 1-Phenanthrenamine; 1-Phenanthrylamine; 1-Aminophenanthrene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 |
| CAS Registry Number | 4176-53-8 |
| SMILES | C1=CC3=C(C2=C1C(=CC=C2)N)C=CC=C3 |
| InChI | 1S/C14H11N/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9H,15H2 |
| InChIKey | CXZOCEZMGWOOFD-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.206°C at 760 mmHg (Cal.) |
| Flash point | 224.415°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Aminophenanthrene |