|
CAS#: 422-49-1 Product: 1,1,1,3,3-Pentachloro-2,2-difluoropropane No suppilers available for the product. |
| Name | 1,1,1,3,3-Pentachloro-2,2-difluoropropane |
|---|---|
| Synonyms | 1,1,1,3,3-Pentachloro-2,2-Difluoro-Propane; 1,1,3,3,3-Pentachloro-2,2-Difluoropropane; Hcfc-222 |
| Molecular Structure | ![]() |
| Molecular Formula | C3HCl5F2 |
| Molecular Weight | 252.30 |
| CAS Registry Number | 422-49-1 |
| SMILES | C(C(F)(C(Cl)(Cl)Cl)F)(Cl)Cl |
| InChI | 1S/C3HCl5F2/c4-1(5)2(9,10)3(6,7)8/h1H |
| InChIKey | GZLCKAJTSZKIBZ-UHFFFAOYSA-N |
| Density | 1.724g/cm3 (Cal.) |
|---|---|
| Boiling point | 169.147°C at 760 mmHg (Cal.) |
| Flash point | 65.562°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,3-Pentachloro-2,2-difluoropropane |