|
CAS#: 42576-08-9 Product: Norpropoxyphene Carbinol No suppilers available for the product. |
| Name | Norpropoxyphene Carbinol |
|---|---|
| Synonyms | Benzeneethanol, Alpha-(1-Methyl-2-(Methylamino)Ethyl)-Alpha-Phenyl-, (S-(R*,S*))-; Norpropoxyphene Carbinol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 |
| CAS Registry Number | 42576-08-9 |
| SMILES | [C@@](CC1=CC=CC=C1)(O)(C2=CC=CC=C2)[C@@H](CNC)C |
| InChI | 1S/C18H23NO/c1-15(14-19-2)18(20,17-11-7-4-8-12-17)13-16-9-5-3-6-10-16/h3-12,15,19-20H,13-14H2,1-2H3/t15-,18+/m1/s1 |
| InChIKey | AONRUTIUKXIKAZ-QAPCUYQASA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.978°C at 760 mmHg (Cal.) |
| Flash point | 108.88°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Norpropoxyphene Carbinol |