|
CAS#: 42583-55-1 Product: Carmetizide No suppilers available for the product. |
| Name | Carmetizide |
|---|---|
| Synonyms | 6-Chloro-2-Methyl-1,1-Dioxo-7-Sulfamoyl-3,4-Dihydrobenzo[E][1,2,4]Thiadiazine-3-Carboxylic Acid Methyl Ester; 6-Chloro-1,1-Diketo-2-Methyl-7-Sulfamoyl-3,4-Dihydrobenzo[E][1,2,4]Thiadiazine-3-Carboxylic Acid Methyl Ester; 2H-1,2,4-Benzothiadiazine-3-Carboxylic Acid, 7-(Aminosulfonyl)-6-Chloro-3,4-Dihydro-2-Methyl-, Methyl Ester, 1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClN3O6S2 |
| Molecular Weight | 369.79 |
| CAS Registry Number | 42583-55-1 |
| SMILES | C1=C(Cl)C(=CC2=C1NC(C(OC)=O)N([S]2(=O)=O)C)[S](N)(=O)=O |
| InChI | 1S/C10H12ClN3O6S2/c1-14-9(10(15)20-2)13-6-3-5(11)7(21(12,16)17)4-8(6)22(14,18)19/h3-4,9,13H,1-2H3,(H2,12,16,17) |
| InChIKey | PFRBORHNFYMVOA-UHFFFAOYSA-N |
| Density | 1.619g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.402°C at 760 mmHg (Cal.) |
| Flash point | 310.26°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carmetizide |