|
CAS#: 42978-77-8 Product: Cobalt Toluate No suppilers available for the product. |
| Name | Cobalt Toluate |
|---|---|
| Synonyms | Benzoic Acid, Methyl-, Cobalt Salt; Cobalt Methylbenzoate; Cobalt Toluate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7CoO2 |
| Molecular Weight | 194.08 |
| CAS Registry Number | 42978-77-8 |
| EINECS | 256-033-8 |
| SMILES | [Co].C1=C(C(=CC=C1)C([O-])=O)C |
| InChI | 1S/C8H8O2.Co/c1-6-4-2-3-5-7(6)8(9)10;/h2-5H,1H3,(H,9,10);/p-1 |
| InChIKey | UWXAPBKOMPDPJS-UHFFFAOYSA-M |
| Boiling point | 260.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 118.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cobalt Toluate |