|
CAS#: 4329-01-5 Product: 2-(4-Chlorophenyl)-2-Phenyl-1,1,1-Trichloroethane No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-2-Phenyl-1,1,1-Trichloroethane |
|---|---|
| Synonyms | 1-Chloro-4-(2,2,2-Trichloro-1-Phenyl-Ethyl)Benzene; Ethane, 2-(4-Chlorophenyl)-2-Phenyl-1,1,1-Trichloro-; Nsc406216 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Cl4 |
| Molecular Weight | 320.05 |
| CAS Registry Number | 4329-01-5 |
| SMILES | C1=CC(=CC=C1Cl)C(C2=CC=CC=C2)C(Cl)(Cl)Cl |
| InChI | 1S/C14H10Cl4/c15-12-8-6-11(7-9-12)13(14(16,17)18)10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | HDIPMQACTWCQQR-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.738°C at 760 mmHg (Cal.) |
| Flash point | 184.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-2-Phenyl-1,1,1-Trichloroethane |