|
CAS#: 439-64-5 Product: 17a-Hydroxyyohimban-16a-Methanol 16,17-cyclic sulfite ester No suppilers available for the product. |
| Name | 17a-Hydroxyyohimban-16a-Methanol 16,17-cyclic sulfite ester |
|---|---|
| Synonyms | Yohimbyl Alcohol Cyclic Sulfite Ester; Brn 0901334 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.48 |
| CAS Registry Number | 439-64-5 |
| SMILES | C1=CC=C2C(=C1)[NH]C3=C2CCN4C3CC5C(C4)CCC6C5CO[S](O6)=O |
| InChI | 1S/C20H24N2O3S/c23-26-24-11-16-15-9-18-20-14(13-3-1-2-4-17(13)21-20)7-8-22(18)10-12(15)5-6-19(16)25-26/h1-4,12,15-16,18-19,21H,5-11H2 |
| InChIKey | LQYRZOSVKDSOFB-UHFFFAOYSA-N |
| Density | 1.455g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.342°C at 760 mmHg (Cal.) |
| Flash point | 298.733°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17a-Hydroxyyohimban-16a-Methanol 16,17-cyclic sulfite ester |