|
CAS#: 4559-64-2 Product: 2,3-Diamino-7-Chlorophenazine No suppilers available for the product. |
| Name | 2,3-Diamino-7-Chlorophenazine |
|---|---|
| Synonyms | (3-Amino-8-Chloro-Phenazin-2-Yl)Amine; 0-25-00-00393 (Beilstein Handbook Reference); 2,3-Diamino-7-Chlorophenazine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.68 |
| CAS Registry Number | 4559-64-2 |
| SMILES | C2=C(Cl)C=C1N=C3C(=NC1=C2)C=C(C(=C3)N)N |
| InChI | 1S/C12H9ClN4/c13-6-1-2-9-10(3-6)17-12-5-8(15)7(14)4-11(12)16-9/h1-5H,14-15H2 |
| InChIKey | SAKWMMOWGNCYFV-UHFFFAOYSA-N |
| Density | 1.523g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.936°C at 760 mmHg (Cal.) |
| Flash point | 271.272°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Diamino-7-Chlorophenazine |