| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Name | (E)-4-Nitro-4'-Methoxystilbene |
|---|---|
| Synonyms | 1-[(E)-2-(4-Methoxyphenyl)Ethenyl]-4-Nitrobenzene; 1-[2-(4-Methoxyphenyl)Vinyl]-4-Nitro-Benzene; 1-[(E)-2-(4-Methoxyphenyl)Vinyl]-4-Nitro-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 |
| CAS Registry Number | 4648-33-3 (1472-68-0) |
| SMILES | C1=CC(=CC=C1\C=C\C2=CC=C(OC)C=C2)[N+](=O)[O-] |
| InChI | 1S/C15H13NO3/c1-19-15-10-6-13(7-11-15)3-2-12-4-8-14(9-5-12)16(17)18/h2-11H,1H3/b3-2+ |
| InChIKey | PDFBJCRLHMEJQP-NSCUHMNNSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Melting point | 133°C (Expl.) |
| Boiling point | 392.883°C at 760 mmHg (Cal.) |
| Flash point | 166.584°C (Cal.) |
| (1) | Helmut Görner. Photoreduction of trans-4-R-4'-nitrostilbenes with R: OMe, H and NO by di- and trialkylamines in polar media, Phys. Chem. Chem. Phys., 2002, 4, 482. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (E)-4-Nitro-4'-Methoxystilbene |