|
CAS#: 46900-82-7 Product: Hydroxyaniline Mustard Phosphate No suppilers available for the product. |
| Name | Hydroxyaniline Mustard Phosphate |
|---|---|
| Synonyms | 4-(Bis(2-Chloroethyl)Amino)Phenol Dihydrogen Phosphate; Hydroxyaniline Mustard Phosphate; P-Di-Chloroethylaminophenyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14Cl2NO4P |
| Molecular Weight | 314.10 |
| CAS Registry Number | 46900-82-7 |
| SMILES | C1=CC(=CC=C1O[P](=O)(O)O)N(CCCl)CCCl |
| InChI | 1S/C10H14Cl2NO4P/c11-5-7-13(8-6-12)9-1-3-10(4-2-9)17-18(14,15)16/h1-4H,5-8H2,(H2,14,15,16) |
| InChIKey | LJMDUALNSRAEPE-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.519°C at 760 mmHg (Cal.) |
| Flash point | 258.924°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hydroxyaniline Mustard Phosphate |