|
CAS#: 4712-49-6 Product: 4,6-Dimethyl[1,2,5]Thiadiazolo[3,4-d]Pyrimidine-5,7(4H,6H)-Dione No suppilers available for the product. |
| Name | 4,6-Dimethyl[1,2,5]Thiadiazolo[3,4-d]Pyrimidine-5,7(4H,6H)-Dione |
|---|---|
| Synonyms | 4,6-Dimethyl-[1,2,5]Thiadiazolo[3,4-E]Pyrimidine-5,7-Quinone; 1,3-Dimethyl-8-Thiaxanthin; 4,6-Dimethyl(1,2,5)Thiadiazolo(3,4-D)Pyrimidine-5,7(4H,6H)-Dion |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N4O2S |
| Molecular Weight | 198.20 |
| CAS Registry Number | 4712-49-6 |
| SMILES | CN2C1=NSN=C1C(N(C2=O)C)=O |
| InChI | 1S/C6H6N4O2S/c1-9-4-3(7-13-8-4)5(11)10(2)6(9)12/h1-2H3 |
| InChIKey | GWYVUXRHNDIFDH-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.655°C at 760 mmHg (Cal.) |
| Flash point | 158.008°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethyl[1,2,5]Thiadiazolo[3,4-d]Pyrimidine-5,7(4H,6H)-Dione |