|
CAS#: 482-98-4 Product: 16,18-Reserpinediol No suppilers available for the product. |
| Name | 16,18-Reserpinediol |
|---|---|
| Synonyms | Reserpic Alcohol; Reserpinediol; 16,18-Reserpinediol |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 |
| CAS Registry Number | 482-98-4 |
| SMILES | [C@H]5(OC)[C@H](O)C[C@@H]4CN3CCC1=C([NH]C2=C1C=CC(=C2)OC)[C@H]3C[C@@H]4[C@@H]5CO |
| InChI | 1S/C22H30N2O4/c1-27-13-3-4-14-15-5-6-24-10-12-7-20(26)22(28-2)17(11-25)16(12)9-19(24)21(15)23-18(14)8-13/h3-4,8,12,16-17,19-20,22-23,25-26H,5-7,9-11H2,1-2H3/t12-,16+,17+,19-,20-,22-/m1/s1 |
| InChIKey | YCLAQLTVHNAEEQ-UALTWCDSSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 597.021°C at 760 mmHg (Cal.) |
| Flash point | 314.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16,18-Reserpinediol |