| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | Kokusaginine |
|---|---|
| Synonyms | 6,7-Dimethoxydictamnine; Mls000574882; Smr000156276 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 |
| CAS Registry Number | 484-08-2 |
| SMILES | C1=C(OC)C(=CC2=C1C(=C3C(=N2)OC=C3)OC)OC |
| InChI | 1S/C14H13NO4/c1-16-11-6-9-10(7-12(11)17-2)15-14-8(4-5-19-14)13(9)18-3/h4-7H,1-3H3 |
| InChIKey | JBRXRVFXQIKPEA-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.628°C at 760 mmHg (Cal.) |
| Flash point | 196.698°C (Cal.) |
| (1) | J. Latip, N. H. M. Ali and B. M. Yamin. 4,6,7-Trimethoxyfuro[2,3-b]quinoline-water (2/3), Acta Cryst. (2005). E61, o2230-o2232 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Kokusaginine |