|
CAS#: 49828-25-3 Product: Kayahope No suppilers available for the product. |
| Name | Kayahope |
|---|---|
| Synonyms | 1-Chloro-4-(4-Nitrophenoxy)-2-Propylsulfanyl-Benzene; 1-Chloro-4-(4-Nitrophenoxy)-2-(Propylthio)Benzene; Brn 2009972 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.79 |
| CAS Registry Number | 49828-25-3 |
| SMILES | C1=C(SCCC)C(=CC=C1OC2=CC=C([N+]([O-])=O)C=C2)Cl |
| InChI | 1S/C15H14ClNO3S/c1-2-9-21-15-10-13(7-8-14(15)16)20-12-5-3-11(4-6-12)17(18)19/h3-8,10H,2,9H2,1H3 |
| InChIKey | SPJLQKZVWZEOOR-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.295°C at 760 mmHg (Cal.) |
| Flash point | 207.987°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Kayahope |