|
CAS#: 49848-04-6 Product: Prorenone No suppilers available for the product. |
| Name | Prorenone |
|---|---|
| Synonyms | 3-(17Beta-Hydroxy-6Beta,7Beta-Methylene-3-Oxo-4-Androsten-17Alpha-Yl)Propionic Acid Gamma-Lactone; Prorenone; Sc 23133 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 |
| CAS Registry Number | 49848-04-6 |
| SMILES | [C@H]35[C@H]2[C@@]([C@@]1(OC(=O)CC1)CC2)(CC[C@@H]3[C@@]4(C(=CC(=O)CC4)[C@@H]6[C@H]5C6)C)C |
| InChI | 1S/C23H30O3/c1-21-7-3-13(24)11-18(21)14-12-15(14)20-16(21)4-8-22(2)17(20)5-9-23(22)10-6-19(25)26-23/h11,14-17,20H,3-10,12H2,1-2H3/t14-,15+,16-,17-,20+,21+,22-,23+/m0/s1 |
| InChIKey | RRHHMFQGHCFGMH-LAPLKBAYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.496°C at 760 mmHg (Cal.) |
| Flash point | 235.264°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Prorenone |