|
CAS#: 50585-37-0 Product: 2,3-Dibromodibenzo-p-Dioxin No suppilers available for the product. |
| Name | 2,3-Dibromodibenzo-p-Dioxin |
|---|---|
| Synonyms | 2,3-Dibromodibenzo-P-Dioxin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Br2O2 |
| Molecular Weight | 341.99 |
| CAS Registry Number | 50585-37-0 |
| SMILES | C1=C(Br)C(=CC2=C1OC3=C(O2)C=CC=C3)Br |
| InChI | 1S/C12H6Br2O2/c13-7-5-11-12(6-8(7)14)16-10-4-2-1-3-9(10)15-11/h1-6H |
| InChIKey | OBHJJRTXDMGYAE-UHFFFAOYSA-N |
| Density | 1.894g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.921°C at 760 mmHg (Cal.) |
| Flash point | 155.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dibromodibenzo-p-Dioxin |