|
CAS#: 50698-76-5 Product: S-(Carboxymethyl)-D-Cysteine No suppilers available for the product. |
| Name | S-(Carboxymethyl)-D-Cysteine |
|---|---|
| Synonyms | (2S)-2-Amino-3-(Carboxymethylthio)Propanoic Acid; (2S)-2-Amino-3-(Carboxymethylthio)Propionic Acid; S-(Carboxymethyl)-D-Cysteine |
| Molecular Structure | ![]() |
| Molecular Formula | C5H9NO4S |
| Molecular Weight | 179.19 |
| CAS Registry Number | 50698-76-5 |
| EINECS | 256-722-3 |
| SMILES | [C@H](CSCC(=O)O)(N)C(=O)O |
| InChI | 1S/C5H9NO4S/c6-3(5(9)10)1-11-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChIKey | GBFLZEXEOZUWRN-GSVOUGTGSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.328°C at 760 mmHg (Cal.) |
| Flash point | 206.193°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(Carboxymethyl)-D-Cysteine |