|
CAS#: 50939-39-4 Product: [5-Chloro-2-[(2,2,2-Trifluoroethyl)Amino]Phenyl] 2-Fluorophenyl Ketone No suppilers available for the product. |
| Name | [5-Chloro-2-[(2,2,2-Trifluoroethyl)Amino]Phenyl] 2-Fluorophenyl Ketone |
|---|---|
| Synonyms | (5-Chloro-2-((2,2,2-Trifluoroethyl)Amino)Phenyl) 2-Fluorophenyl Ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10ClF4NO |
| Molecular Weight | 331.70 |
| CAS Registry Number | 50939-39-4 |
| EINECS | 256-864-6 |
| SMILES | C1=C(Cl)C=CC(=C1C(=O)C2=CC=CC=C2F)NCC(F)(F)F |
| InChI | 1S/C15H10ClF4NO/c16-9-5-6-13(21-8-15(18,19)20)11(7-9)14(22)10-3-1-2-4-12(10)17/h1-7,21H,8H2 |
| InChIKey | VGNVFAXJHFXDAT-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.227°C at 760 mmHg (Cal.) |
| Flash point | 232.742°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [5-Chloro-2-[(2,2,2-Trifluoroethyl)Amino]Phenyl] 2-Fluorophenyl Ketone |