|
CAS#: 50957-96-5 Product: Phosphoric Acid, Dodecyl Ester, Sodium Salt No suppilers available for the product. |
| Name | Phosphoric Acid, Dodecyl Ester, Sodium Salt |
|---|---|
| Synonyms | Disodium Lauryl Phosphate; Lauryl Phosphate, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H25Na2O4P |
| Molecular Weight | 310.28 |
| CAS Registry Number | 50957-96-5 |
| EINECS | 256-865-1 |
| SMILES | C(CCCCCCCCCC)CO[P](=O)([O-])[O-].[Na+].[Na+] |
| InChI | 1S/C12H27O4P.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;;/h2-12H2,1H3,(H2,13,14,15);;/q;2*+1/p-2 |
| InChIKey | YVIGPQSYEAOLAD-UHFFFAOYSA-L |
| Boiling point | 385.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric Acid, Dodecyl Ester, Sodium Salt |