Online Database of Chemicals from Around the World
|
CAS#: 511-34-2 Product: (25R)-5alpha-Spirostane-2alpha,3beta,15beta-Triol No suppilers available for the product. |
| Name | (25R)-5alpha-Spirostane-2alpha,3beta,15beta-Triol |
|---|---|
| Synonyms | Chebi:28431; C08896; Digitogenin |
| Molecular Structure |  |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 |
| CAS Registry Number | 511-34-2 |
| SMILES | [C@]24([C@H]([C@@H]1CC[C@@H]3[C@@]([C@H]1CC2)(C[C@H]([C@H](O)C3)O)C)[C@H](O)[C@H]6[C@@H]4[C@@H]([C@]5(OC[C@@H](CC5)C)O6)C)C |
| InChI | 1S/C27H44O5/c1-14-7-10-27(31-13-14)15(2)21-24(32-27)23(30)22-17-6-5-16-11-19(28)20(29)12-26(16,4)18(17)8-9-25(21,22)3/h14-24,28-30H,5-13H2,1-4H3/t14-,15+,16+,17-,18+,19-,20-,21+,22-,23+,24-,25-,26+,27-/m1/s1 |
| InChIKey | COVOPPXLDJVUSC-JPYPKGSXSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.9±50.0°C at 760 mmHg (Cal.) |
| Flash point | 299.7±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (25R)-5alpha-Spirostane-2alpha,3beta,15beta-Triol |