|
CAS#: 51112-65-3 Product: 9-Benzyl-6-Methylsulfanyl-Purin-2-Amine No suppilers available for the product. |
| Name | 9-Benzyl-6-Methylsulfanyl-Purin-2-Amine |
|---|---|
| Synonyms | 6-(Methylthio)-9-(Phenylmethyl)-2-Purinamine; [9-(Benzyl)-6-(Methylthio)Purin-2-Yl]Amine; Nsc42380 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.34 |
| CAS Registry Number | 51112-65-3 |
| SMILES | C2=NC1=C(N=C(N)N=C1SC)[N]2CC3=CC=CC=C3 |
| InChI | 1S/C13H13N5S/c1-19-12-10-11(16-13(14)17-12)18(8-15-10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,14,16,17) |
| InChIKey | YDUZAMOWVCAJTJ-UHFFFAOYSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 569.75°C at 760 mmHg (Cal.) |
| Flash point | 298.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Benzyl-6-Methylsulfanyl-Purin-2-Amine |