|
CAS#: 5116-63-2 Product: 1H-Phenalene-1,2,3-trione No suppilers available for the product. |
| Name | 1H-Phenalene-1,2,3-trione |
|---|---|
| Synonyms | Nsc243696 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H6O3 |
| Molecular Weight | 210.19 |
| CAS Registry Number | 5116-63-2 |
| SMILES | C3=C1C(C(C(C2=CC=CC(=C12)C=C3)=O)=O)=O |
| InChI | 1S/C13H6O3/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13(11)16/h1-6H |
| InChIKey | VUJNWSHCZKZTMI-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.624°C at 760 mmHg (Cal.) |
| Flash point | 202.46°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1H-Phenalene-1,2,3-trione |