|
CAS#: 51956-43-5 Product: Dichloro(4-Nitrophenyl)Arsine No suppilers available for the product. |
| Name | Dichloro(4-Nitrophenyl)Arsine |
|---|---|
| Synonyms | Arsine, Dichloro(P-Nitrophenyl)-; Brn 2834253; Tl 68 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4AsCl2NO2 |
| Molecular Weight | 267.93 |
| CAS Registry Number | 51956-43-5 |
| SMILES | C1=C([As](Cl)Cl)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C6H4AsCl2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4H |
| InChIKey | QGHBRUGQGDWTSP-UHFFFAOYSA-N |
| Boiling point | 349.07°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 164.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloro(4-Nitrophenyl)Arsine |