|
CAS#: 52101-36-7 Product: Methyl 3,4-Diphenyl-2-Furoate No suppilers available for the product. |
| Name | Methyl 3,4-Diphenyl-2-Furoate |
|---|---|
| Synonyms | 3,4-Di(Phenyl)-2-Furancarboxylic Acid Methyl Ester; 3,4-Di(Phenyl)Furan-2-Carboxylic Acid Methyl Ester; Ccris 2159 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 |
| CAS Registry Number | 52101-36-7 |
| SMILES | C1=C(C(=C(O1)C(=O)OC)C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C18H14O3/c1-20-18(19)17-16(14-10-6-3-7-11-14)15(12-21-17)13-8-4-2-5-9-13/h2-12H,1H3 |
| InChIKey | UGNQSWFJOLHGLP-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.379°C at 760 mmHg (Cal.) |
| Flash point | 210.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,4-Diphenyl-2-Furoate |