Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054//+86 13424336463 | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Nitro-2-Vinylbenzoic Acid |
|---|---|
| Synonyms | 2-ethenyl-3-nitrobenzoic acid; 3-nitro-2-vinylbenzoic acid |
| Molecular Structure |  |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 |
| CAS Registry Number | 521074-27-1 |
| SMILES | O=N(=O)c1cccc(c1C=C)C(O)=O |
| InChI | 1S/C9H7NO4/c1-2-6-7(9(11)12)4-3-5-8(6)10(13)14/h2-5H,1H2,(H,11,12) |
| InChIKey | QYRLGZIKRAGEQG-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.83°C at 760 mmHg (Cal.) |
| Flash point | 163.456°C (Cal.) |
| Refractive index | 1.644 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-2-Vinylbenzoic Acid |