|
CAS#: 52704-98-0 Product: [1,1'-Biphenyl]-2-ol ammonium salt No suppilers available for the product. |
| Name | [1,1'-Biphenyl]-2-ol ammonium salt |
|---|---|
| Synonyms | Ammonia; 2-Phenylphenol; (1,1'-Biphenyl)-2-Ol, Ammonium Salt; Ammonium 2-Phenylphenate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| CAS Registry Number | 52704-98-0 |
| SMILES | C1=CC=CC(=C1)C2=CC=CC=C2O.N |
| InChI | 1S/C12H10O.H3N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;1H3 |
| InChIKey | WTPWCIBYJWGZHI-UHFFFAOYSA-N |
| Boiling point | 282°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 140.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1,1'-Biphenyl]-2-ol ammonium salt |