| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 4-Ethoxy-3-Methoxybenzaldehyde ethylene acetal |
|---|---|
| Synonyms | 2-(4-Ethoxy-3-Methoxy-Phenyl)-1,3-Dioxolane; Nsc58651 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 52987-93-6 |
| SMILES | C2=C(C1OCCO1)C=CC(=C2OC)OCC |
| InChI | 1S/C12H16O4/c1-3-14-10-5-4-9(8-11(10)13-2)12-15-6-7-16-12/h4-5,8,12H,3,6-7H2,1-2H3 |
| InChIKey | NFXDSTGOUAXWHN-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.247°C at 760 mmHg (Cal.) |
| Flash point | 124.237°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxy-3-Methoxybenzaldehyde ethylene acetal |