|
CAS#: 53207-50-4 Product: 7-Chloro-2,3-Dihydro-1,3-Dimethylquinolin-4(1H)-One No suppilers available for the product. |
| Name | 7-Chloro-2,3-Dihydro-1,3-Dimethylquinolin-4(1H)-One |
|---|---|
| Synonyms | 4-Quinolinone, 1,2,3,4-Tetrahydro-7-Chloro-1,3-Dimethyl-; 7-Chloro-1,3-Dimethyl-1,2,3,4-Tetrahydro-4-Quinolinone; Brn 1455718 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.67 |
| CAS Registry Number | 53207-50-4 |
| SMILES | C1=C(C=CC2=C1N(CC(C2=O)C)C)Cl |
| InChI | 1S/C11H12ClNO/c1-7-6-13(2)10-5-8(12)3-4-9(10)11(7)14/h3-5,7H,6H2,1-2H3 |
| InChIKey | KDBHLDQRLXPURK-UHFFFAOYSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.729°C at 760 mmHg (Cal.) |
| Flash point | 163.496°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-2,3-Dihydro-1,3-Dimethylquinolin-4(1H)-One |