|
CAS#: 53250-34-3 Product: 1,2-Dihydroxy-5,6-dioxohexane-3-sulfonic acid No suppilers available for the product. |
| Name | 1,2-Dihydroxy-5,6-dioxohexane-3-sulfonic acid |
|---|---|
| Synonyms | 1,2-Dihydroxy-5,6-Dioxo-Hexane-3-Sulfonic Acid; 1,2-Dihydroxy-5,6-Diketo-Hexane-3-Sulfonic Acid; 2-Hexulosonic Acid, 3,4-Dideoxy-4-Sulfo- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10O7S |
| Molecular Weight | 226.20 |
| CAS Registry Number | 53250-34-3 |
| SMILES | C(O)C(C(CC(C=O)=O)[S](O)(=O)=O)O |
| InChI | 1S/C6H10O7S/c7-2-4(9)1-6(5(10)3-8)14(11,12)13/h2,5-6,8,10H,1,3H2,(H,11,12,13) |
| InChIKey | HGCDJOFNOVKMQN-UHFFFAOYSA-N |
| Density | 1.659g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydroxy-5,6-dioxohexane-3-sulfonic acid |