|
CAS#: 53497-45-3 Product: Nitrotyrosine Ethyl Ester No suppilers available for the product. |
| Name | Nitrotyrosine Ethyl Ester |
|---|---|
| Synonyms | Ethyl (2S)-2-Amino-3-(4-Hydroxy-3-Nitro-Phenyl)Propanoate; (2S)-2-Amino-3-(4-Hydroxy-3-Nitrophenyl)Propanoic Acid Ethyl Ester; (2S)-2-Amino-3-(4-Hydroxy-3-Nitro-Phenyl)Propionic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 |
| CAS Registry Number | 53497-45-3 |
| SMILES | [C@H](C(=O)OCC)(N)CC1=CC(=C(O)C=C1)[N+](=O)[O-] |
| InChI | 1S/C11H14N2O5/c1-2-18-11(15)8(12)5-7-3-4-10(14)9(6-7)13(16)17/h3-4,6,8,14H,2,5,12H2,1H3/t8-/m0/s1 |
| InChIKey | VDFGKWYGLJURQQ-QMMMGPOBSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.891°C at 760 mmHg (Cal.) |
| Flash point | 188.995°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitrotyrosine Ethyl Ester |