|
CAS#: 53718-35-7 Product: 6-Chloro-1,1,3,3-Tetramethylindan-5-Ol No suppilers available for the product. |
| Name | 6-Chloro-1,1,3,3-Tetramethylindan-5-Ol |
|---|---|
| Synonyms | 6-Chloro-1,1,3,3-Tetramethyl-Indan-5-Ol; 6-Chloro-1,1,3,3-Tetramethyl-5-Indanol; 6-Chloro-1,1,3,3-Tetramethylindan-5-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 |
| CAS Registry Number | 53718-35-7 |
| EINECS | 258-723-4 |
| SMILES | C1=C(C(=CC2=C1C(CC2(C)C)(C)C)O)Cl |
| InChI | 1S/C13H17ClO/c1-12(2)7-13(3,4)9-6-11(15)10(14)5-8(9)12/h5-6,15H,7H2,1-4H3 |
| InChIKey | PMWJZWDTSSMFEP-UHFFFAOYSA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.675°C at 760 mmHg (Cal.) |
| Flash point | 133.224°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1,1,3,3-Tetramethylindan-5-Ol |