|
CAS#: 54100-59-3 Product: 1,2,4,5-[2.2.2.2]Cyclophane No suppilers available for the product. |
| Name | 1,2,4,5-[2.2.2.2]Cyclophane |
|---|---|
| Synonyms | [2.2.2.2](1,2,4,5)Cyclophane; 1,2,4,5-(2.2.2.2)-Cyclophane |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 |
| CAS Registry Number | 54100-59-3 |
| SMILES | C5C1=C4C=C3C(=C1)CCC2=CC(=C(C=C2CC3)CC4)C5 |
| InChI | 1S/C20H20/c1-2-14-10-18-6-5-16-9-13(1)15-3-4-17(14)12-20(18)8-7-19(16)11-15/h9-12H,1-8H2 |
| InChIKey | VKBBYQHRVDUAIS-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.576°C at 760 mmHg (Cal.) |
| Flash point | 190.363°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-[2.2.2.2]Cyclophane |