|
CAS#: 545-68-6 Product: 3,15,16-Trimethoxy-1,2,6,7-Tetradehydroerythrinan No suppilers available for the product. |
| Name | 3,15,16-Trimethoxy-1,2,6,7-Tetradehydroerythrinan |
|---|---|
| Synonyms | erysopine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.39 |
| CAS Registry Number | 545-68-6 |
| SMILES | O(c1cc2c(cc1OC)CCN3C24C(=C/C3)\C=C/C(OC)C4)C |
| InChI | 1S/C19H23NO3/c1-21-15-5-4-14-7-9-20-8-6-13-10-17(22-2)18(23-3)11-16(13)19(14,20)12-15/h4-5,7,10-11,15H,6,8-9,12H2,1-3H3 |
| InChIKey | WXVSPYOOFCCEII-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.801°C at 760 mmHg (Cal.) |
| Flash point | 141.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,15,16-Trimethoxy-1,2,6,7-Tetradehydroerythrinan |