|
CAS#: 54617-22-0 Product: 2-Methylenesuccinic Acid, Potassium Salt No suppilers available for the product. |
| Name | 2-Methylenesuccinic Acid, Potassium Salt |
|---|---|
| Synonyms | Dipotassium 2-Methylenebutanedioate; Dipotassium Itaconate; 2-Methylenesuccinic Acid, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4K2O4 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 54617-22-0 |
| EINECS | 259-256-9 |
| SMILES | C(C(C([O-])=O)=C)C([O-])=O.[K+].[K+] |
| InChI | 1S/C5H6O4.2K/c1-3(5(8)9)2-4(6)7;;/h1-2H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
| InChIKey | RBYDCVNTVVKIQT-UHFFFAOYSA-L |
| Boiling point | 381.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 198.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylenesuccinic Acid, Potassium Salt |