|
CAS#: 54810-87-6 Product: 3,5-Dimethyl-4-nitrobiphenyl No suppilers available for the product. |
| Name | 3,5-Dimethyl-4-nitrobiphenyl |
|---|---|
| Synonyms | 1,3-Dimethyl-2-Nitro-5-Phenyl-Benzene; 1,1'-Biphenyl, 3,5-Dimethyl-4-Nitro-; 3,5-Dimethyl-4-Nitro-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 54810-87-6 |
| SMILES | C2=C(C1=CC=CC=C1)C=C(C)C(=C2C)[N+](=O)[O-] |
| InChI | 1S/C14H13NO2/c1-10-8-13(12-6-4-3-5-7-12)9-11(2)14(10)15(16)17/h3-9H,1-2H3 |
| InChIKey | AWZXPCPKJAORSZ-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.393°C at 760 mmHg (Cal.) |
| Flash point | 149.919°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethyl-4-nitrobiphenyl |