|
CAS#: 54965-32-1 Product: 5-(1-Cyclohepten-1-Yl)-5-Ethyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione No suppilers available for the product. |
| Name | 5-(1-Cyclohepten-1-Yl)-5-Ethyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |
|---|---|
| Synonyms | 5-(1-Cycl |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 54965-32-1 |
| SMILES | O=C1N(C(=O)C(C(=O)N1C)(/C2=C/CCCCC2)CC)C |
| InChI | 1S/C15H22N2O3/c1-4-15(11-9-7-5-6-8-10-11)12(18)16(2)14(20)17(3)13(15)19/h9H,4-8,10H2,1-3H3 |
| InChIKey | IOWZYALHIKMITA-UHFFFAOYSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.225°C at 760 mmHg (Cal.) |
| Flash point | 148.362°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Cyclohepten-1-Yl)-5-Ethyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |