|
CAS#: 550-53-8 Product: Isopropylmethoxamine No suppilers available for the product. |
| Name | Isopropylmethoxamine |
|---|---|
| Synonyms | 1-(2,5-Dimethoxyphenyl)-2-(Isopropylamino)Propan-1-Ol Hydrochloride; 2,5-Dimethoxy-Alpha-(2-(Isopropylamino)Ethyl)Benzyl Alcohol, Hydrochloride; Benzyl Alcohol, 2,5-Dimethoxy-Alpha-(1-(Isopropylamino)Ethyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24ClNO3 |
| Molecular Weight | 289.80 |
| CAS Registry Number | 550-53-8 |
| SMILES | [H+].C1=C(OC)C=CC(=C1C(O)C(NC(C)C)C)OC.[Cl-] |
| InChI | 1S/C14H23NO3.ClH/c1-9(2)15-10(3)14(16)12-8-11(17-4)6-7-13(12)18-5;/h6-10,14-16H,1-5H3;1H |
| InChIKey | PDUFACBDZZVKBL-UHFFFAOYSA-N |
| Boiling point | 382.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 185.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropylmethoxamine |