Online Database of Chemicals from Around the World
|
CAS#: 55130-39-7 Product: Diethyl 2-(ethoxymethylidene)-3-oxo-butanedioate No suppilers available for the product. |
| Name | Diethyl 2-(ethoxymethylidene)-3-oxo-butanedioate |
|---|---|
| Synonyms | Diethyl (2Z)-2-(Ethoxymethylidene)-3-Oxobutanedioate; Diethyl 2-(Ethoxymethylene)-3-Oxo-Butanedioate; Diethyl (2Z)-2-(Ethoxymethylene)-3-Oxo-Butanedioate |
| Molecular Structure |  |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 |
| CAS Registry Number | 55130-39-7 |
| SMILES | C(O/C=C(/C(=O)C(=O)OCC)C(=O)OCC)C |
| InChI | 1S/C11H16O6/c1-4-15-7-8(10(13)16-5-2)9(12)11(14)17-6-3/h7H,4-6H2,1-3H3/b8-7- |
| InChIKey | UZVPVDDPMTWWED-FPLPWBNLSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.939°C at 760 mmHg (Cal.) |
| Flash point | 152.04°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 2-(ethoxymethylidene)-3-oxo-butanedioate |