|
CAS#: 55162-96-4 Product: 14-Methylprogesterone No suppilers available for the product. |
| Name | 14-Methylprogesterone |
|---|---|
| Synonyms | (8R,9S,10R,13R,14S,17S)-17-Ethanoyl-10,13,14-Trimethyl-2,6,7,8,9,11,12,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthren-3-One; Nsc76615; Pregn-4-Ene-3,20-Dione, 14-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.49 |
| CAS Registry Number | 55162-96-4 |
| SMILES | [C@@H]4(C(=O)C)[C@]3(CC[C@@H]2[C@]1(CCC(=O)C=C1CC[C@H]2[C@]3(C)CC4)C)C |
| InChI | 1S/C22H32O2/c1-14(23)17-8-11-22(4)19-6-5-15-13-16(24)7-10-20(15,2)18(19)9-12-21(17,22)3/h13,17-19H,5-12H2,1-4H3/t17-,18+,19-,20+,21-,22+/m1/s1 |
| InChIKey | YSLKWPPYLOYLMM-VTJFTLGMSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.025°C at 760 mmHg (Cal.) |
| Flash point | 166.99°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 14-Methylprogesterone |