|
CAS#: 552-98-7 Product: Lithium O-Acetylsalicylate No suppilers available for the product. |
| Name | Lithium O-Acetylsalicylate |
|---|---|
| Synonyms | Lithium 2-Acetoxybenzoate; Lithium O-Acetylsalicylate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7LiO4 |
| Molecular Weight | 186.09 |
| CAS Registry Number | 552-98-7 |
| EINECS | 209-029-5 |
| SMILES | C1=CC=CC(=C1C(=O)[O-])OC(C)=O.[Li+] |
| InChI | 1S/C9H8O4.Li/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;/h2-5H,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | FGLLQDSAOUJRST-UHFFFAOYSA-M |
| Boiling point | 321.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 131.2°C (Cal.) |
| (1) | J.-B. Arlin, F. Addison and A. R. Kennedy. Lithium aspirinate hemihydrate, Acta Cryst. (2007). C63, m563-m565 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Lithium O-Acetylsalicylate |