|
CAS#: 55339-21-4 Product: 2-(Diphosphonomethylamino)Acetic Acid No suppilers available for the product. |
| Name | 2-(Diphosphonomethylamino)Acetic Acid |
|---|---|
| Synonyms | 2-(Diphosphonomethylamino)Ethanoic Acid; N-(Diphosphonomethyl)Glycine |
| Molecular Structure | ![]() |
| Molecular Formula | C3H9NO8P2 |
| Molecular Weight | 249.05 |
| CAS Registry Number | 55339-21-4 |
| EINECS | 259-598-9 |
| SMILES | C(NC([P](=O)(O)O)[P](=O)(O)O)C(=O)O |
| InChI | 1S/C3H9NO8P2/c5-2(6)1-4-3(13(7,8)9)14(10,11)12/h3-4H,1H2,(H,5,6)(H2,7,8,9)(H2,10,11,12) |
| InChIKey | PUOUFDPPEXJKCL-UHFFFAOYSA-N |
| Density | 2.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 688.291°C at 760 mmHg (Cal.) |
| Flash point | 370.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Diphosphonomethylamino)Acetic Acid |