|
CAS#: 55341-64-5 Product: 9H-Fluorene-1-Carbonyl Chloride No suppilers available for the product. |
| Name | 9H-Fluorene-1-Carbonyl Chloride |
|---|---|
| Synonyms | Fluorene-1-Carbonyl Chloride; Nsc80181 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9ClO |
| Molecular Weight | 228.68 |
| CAS Registry Number | 55341-64-5 |
| SMILES | C1=C(C2=C(C=C1)C3=C(C2)C=CC=C3)C(=O)Cl |
| InChI | 1S/C14H9ClO/c15-14(16)12-7-3-6-11-10-5-2-1-4-9(10)8-13(11)12/h1-7H,8H2 |
| InChIKey | XPKVREAMGZMEDB-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.928°C at 760 mmHg (Cal.) |
| Flash point | 184.308°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Fluorene-1-Carbonyl Chloride |