|
CAS#: 55346-51-5 Product: 8-Dimethylaminonaphthalen-2-Ol No suppilers available for the product. |
| Name | 8-Dimethylaminonaphthalen-2-Ol |
|---|---|
| Synonyms | 8-Dimethylamino-2-Naphthalenol; 8-Dimethylamino-2-Naphthol; 1-(N-Dimethyl)Amino-7-Naphthol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| CAS Registry Number | 55346-51-5 |
| SMILES | C1=C2C(=CC=C1O)C=CC=C2N(C)C |
| InChI | 1S/C12H13NO/c1-13(2)12-5-3-4-9-6-7-10(14)8-11(9)12/h3-8,14H,1-2H3 |
| InChIKey | FVIRBOBSIYMISE-UHFFFAOYSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.007°C at 760 mmHg (Cal.) |
| Flash point | 165.174°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Dimethylaminonaphthalen-2-Ol |